|
CAS#: 61132-15-8 Product: Chiriquitoxin No suppilers available for the product. |
| Name | Chiriquitoxin |
|---|---|
| Synonyms | Chiriquitoxin |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20N4O10 |
| Molecular Weight | 392.32 |
| CAS Registry Number | 61132-15-8 |
| SMILES | O=C(O)C(N)C(O)C1(O)C2OC4(OC1C(O)C3(NC(=NC(O)C23)N)C4O)O |
| InChI | 1S/C13H20N4O10/c14-2(8(21)22)3(18)12(24)5-1-7(20)16-10(15)17-11(1)4(19)6(12)27-13(25,26-5)9(11)23/h1-7,9,18-20,23-25H,14H2,(H,21,22)(H3,15,16,17) |
| InChIKey | USXKBURXVCBLKJ-UHFFFAOYSA-N |
| Density | 2.841g/cm3 (Cal.) |
|---|---|
| Boiling point | 929.733°C at 760 mmHg (Cal.) |
| Flash point | 516.084°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chiriquitoxin |