|
CAS#: 611-38-1 Product: (Dinitromethyl)Benzene No suppilers available for the product. |
| Name | (Dinitromethyl)Benzene |
|---|---|
| Synonyms | Benzene, Methyldinitro-; Nsc53381; Dinitrotoluene- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.14 |
| CAS Registry Number | 611-38-1 |
| SMILES | C1=C(C([N+]([O-])=O)[N+]([O-])=O)C=CC=C1 |
| InChI | 1S/C7H6N2O4/c10-8(11)7(9(12)13)6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | VMMLSJNPNVTYMN-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.899°C at 760 mmHg (Cal.) |
| Flash point | 119.69°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Dinitromethyl)Benzene |