|
CAS#: 61152-07-6 Product: 2-(3-Fluorophenyl)-5-Methyloxazole-4-Carboxamide No suppilers available for the product. |
| Name | 2-(3-Fluorophenyl)-5-Methyloxazole-4-Carboxamide |
|---|---|
| Synonyms | 2-(3-Fluorophenyl)-5-Methyl-Oxazole-4-Carboxamide; 2-(3-Fluorophenyl)-5-Methyl-4-Oxazolecarboxamide; 2-(M-Fluorophenyl)-5-Methyloxazole-4-Carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9FN2O2 |
| Molecular Weight | 220.20 |
| CAS Registry Number | 61152-07-6 |
| SMILES | C1=CC=C(C=C1C2=NC(=C(C)O2)C(=O)N)F |
| InChI | 1S/C11H9FN2O2/c1-6-9(10(13)15)14-11(16-6)7-3-2-4-8(12)5-7/h2-5H,1H3,(H2,13,15) |
| InChIKey | WOSHMVUHTCRJIF-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.56°C at 760 mmHg (Cal.) |
| Flash point | 193.028°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Fluorophenyl)-5-Methyloxazole-4-Carboxamide |