|
CAS#: 61153-76-2 Product: Licodione No suppilers available for the product. |
| Name | Licodione |
|---|---|
| Synonyms | C01592; Licodione; Chebi:18131 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 |
| CAS Registry Number | 61153-76-2 |
| SMILES | C1=C(C(=CC=C1O)C(CC(C2=CC=C(C=C2)O)=O)=O)O |
| InChI | 1S/C15H12O5/c16-10-3-1-9(2-4-10)13(18)8-15(20)12-6-5-11(17)7-14(12)19/h1-7,16-17,19H,8H2 |
| InChIKey | QIEKMEBGIJSGGB-UHFFFAOYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 569.018°C at 760 mmHg (Cal.) |
| Flash point | 311.98°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Licodione |