|
CAS#: 61209-66-3 Product: 8-Chloronaphthalene-1-Thiol No suppilers available for the product. |
| Name | 8-Chloronaphthalene-1-Thiol |
|---|---|
| Synonyms | 8-Chloro-1-Naphthalenethiol; 1-Naphthalenethiol, 8-Chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7ClS |
| Molecular Weight | 194.68 |
| CAS Registry Number | 61209-66-3 |
| EINECS | 262-659-2 |
| SMILES | C1=C(Cl)C2=C(C=C1)C=CC=C2S |
| InChI | 1S/C10H7ClS/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,12H |
| InChIKey | YICMQGKNGMHCIU-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.239°C at 760 mmHg (Cal.) |
| Flash point | 133.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Chloronaphthalene-1-Thiol |