|
CAS#: 61380-47-0 Product: 1-Phenyl-2-Propylmethanesulphonate No suppilers available for the product. |
| Name | 1-Phenyl-2-Propylmethanesulphonate |
|---|---|
| Synonyms | Methanesulfonic Acid (1-Methyl-2-Phenyl-Ethyl) Ester; (1-Methyl-2-Phenyl-Ethyl) Methanesulfonate; Methanesulfonic Acid (1-Methyl-2-Phenylethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.28 |
| CAS Registry Number | 61380-47-0 |
| SMILES | C1=CC=CC=C1CC(C)O[S](C)(=O)=O |
| InChI | 1S/C10H14O3S/c1-9(13-14(2,11)12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | KBYZZLVTQKGSLB-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.514°C at 760 mmHg (Cal.) |
| Flash point | 172.438°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-2-Propylmethanesulphonate |