|
CAS#: 61519-05-9 Product: S-(4-Pentylphenyl) 4-(Octyloxy)Benzenecarbothioate No suppilers available for the product. |
| Name | S-(4-Pentylphenyl) 4-(Octyloxy)Benzenecarbothioate |
|---|---|
| Synonyms | 4-(Octyloxy)benzenecarbothioic acid S-(4-pentylphenyl) ester; 4-Pentylphenylthiol 4'-octyloxybenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C26H36O2S |
| Molecular Weight | 412.63 |
| CAS Registry Number | 61519-05-9 |
| SMILES | CCCCCCCCOc1ccc(cc1)C(=O)Sc2ccc(cc2)CCCCC |
| InChI | 1S/C26H36O2S/c1-3-5-7-8-9-11-21-28-24-17-15-23(16-18-24)26(27)29-25-19-13-22(14-20-25)12-10-6-4-2/h13-20H,3-12,21H2,1-2H3 |
| InChIKey | LTYZTPZHKWYMOE-UHFFFAOYSA-N |
| Density | 1.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.676°C at 760 mmHg (Cal.) |
| Flash point | 244.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(4-Pentylphenyl) 4-(Octyloxy)Benzenecarbothioate |