|
CAS#: 61695-69-0 Product: 6-Oxiranylbenzo[a]Pyrene No suppilers available for the product. |
| Name | 6-Oxiranylbenzo[a]Pyrene |
|---|---|
| Synonyms | 2-(6-Benzo[B]Pyrenyl)Oxirane; 6-Oxiranylbenzo(A)Pyrene; Benzo(A)Pyrene, 6-Oxiranyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H14O |
| Molecular Weight | 294.35 |
| CAS Registry Number | 61695-69-0 |
| SMILES | C2=CC1=CC=CC6=C1C3=C(C5=C(C(=C23)C4CO4)C=CC=C5)C=C6 |
| InChI | 1S/C22H14O/c1-2-7-16-15(6-1)17-10-8-13-4-3-5-14-9-11-18(22(17)20(13)14)21(16)19-12-23-19/h1-11,19H,12H2 |
| InChIKey | SZOGYVPLFPZVIH-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 539.481°C at 760 mmHg (Cal.) |
| Flash point | 259.245°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Oxiranylbenzo[a]Pyrene |