|
CAS#: 61702-93-0 Product: 2-(Phenylmethyl)Naphthalene-1-sulphonic Acid No suppilers available for the product. |
| Name | 2-(Phenylmethyl)Naphthalene-1-sulphonic Acid |
|---|---|
| Synonyms | 2-(Phenylmethyl)-1-Naphthalenesulfonic Acid; 2-(Benzyl)Naphthalene-1-Sulfonic Acid; (Phenylmethyl)Naphthalenesulphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O3S |
| Molecular Weight | 298.36 |
| CAS Registry Number | 61702-93-0 |
| EINECS | 262-930-5 |
| SMILES | C1=CC3=C(C(=C1CC2=CC=CC=C2)[S](O)(=O)=O)C=CC=C3 |
| InChI | 1S/C17H14O3S/c18-21(19,20)17-15(12-13-6-2-1-3-7-13)11-10-14-8-4-5-9-16(14)17/h1-11H,12H2,(H,18,19,20) |
| InChIKey | CBCZQJLYYRPMRI-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(Phenylmethyl)Naphthalene-1-sulphonic Acid |