|
CAS#: 61799-74-4 Product: Prostaglandins I2 Methyl Ester No suppilers available for the product. |
| Name | Prostaglandins I2 Methyl Ester |
|---|---|
| Synonyms | (5E)-5-[(3Ar,4R,5R,6As)-5-Hydroxy-4-[(E,3S)-3-Hydroxyoct-1-Enyl]-3,3A,4,5,6,6A-Hexahydrocyclopenta[D]Furan-2-Ylidene]Pentanoic Acid Methyl Ester; (5E)-5-[(3Ar,4R,5R,6As)-5-Hydroxy-4-[(E,3S)-3-Hydroxyoct-1-Enyl]-3,3A,4,5,6,6A-Hexahydrocyclopenta[D]Furan-2-Ylidene]Valeric Acid Methyl Ester; Pgi2 Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 |
| CAS Registry Number | 61799-74-4 |
| SMILES | [C@@H]12[C@@H](OC(/C1)=C/CCCC(OC)=O)C[C@@H](O)[C@@H]2\C=C\[C@@H](O)CCCCC |
| InChI | 1S/C21H34O5/c1-3-4-5-8-15(22)11-12-17-18-13-16(26-20(18)14-19(17)23)9-6-7-10-21(24)25-2/h9,11-12,15,17-20,22-23H,3-8,10,13-14H2,1-2H3/b12-11+,16-9+/t15-,17+,18+,19+,20-/m0/s1 |
| InChIKey | HEPKWABQTOCTFQ-CXTOUWENSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.381°C at 760 mmHg (Cal.) |
| Flash point | 163.013°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Prostaglandins I2 Methyl Ester |