|
CAS#: 61810-04-6 Product: Manganese(2+) Heptanoate No suppilers available for the product. |
| Name | Manganese(2+) Heptanoate |
|---|---|
| Synonyms | Manganous Heptanoate; Manganous Enanthate; Manganese Heptanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H26MnO4 |
| Molecular Weight | 313.30 |
| CAS Registry Number | 61810-04-6 |
| EINECS | 263-236-5 |
| SMILES | C(C([O-])=O)CCCCC.C(C([O-])=O)CCCCC.[Mn++] |
| InChI | 1S/2C7H14O2.Mn/c2*1-2-3-4-5-6-7(8)9;/h2*2-6H2,1H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | NJUDPVIWMUMPLJ-UHFFFAOYSA-L |
| Boiling point | 222.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 99.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese(2+) Heptanoate |