|
CAS#: 61888-67-3 Product: 4'-Chloro-3-(2-Hydroxyethyl)-5-Methoxybiphenyl No suppilers available for the product. |
| Name | 4'-Chloro-3-(2-Hydroxyethyl)-5-Methoxybiphenyl |
|---|---|
| Synonyms | 2-[3-(4-Chlorophenyl)-5-Methoxy-Phenyl]Ethanol; 2-(4'-Chloro-5-Methoxy-3-Biphenylyl)Ethanol; 4'-Chloro-3-(2-Hydroxyethyl)-5-Methoxybiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15ClO2 |
| Molecular Weight | 262.74 |
| CAS Registry Number | 61888-67-3 |
| SMILES | C1=C(C=C(C=C1C2=CC=C(C=C2)Cl)OC)CCO |
| InChI | 1S/C15H15ClO2/c1-18-15-9-11(6-7-17)8-13(10-15)12-2-4-14(16)5-3-12/h2-5,8-10,17H,6-7H2,1H3 |
| InChIKey | ZJURXWFDOGPTFH-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.82°C at 760 mmHg (Cal.) |
| Flash point | 195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Chloro-3-(2-Hydroxyethyl)-5-Methoxybiphenyl |