|
CAS#: 61925-87-9 Product: 2,3,6-Trichlorophenol Acetate No suppilers available for the product. |
| Name | 2,3,6-Trichlorophenol Acetate |
|---|---|
| Synonyms | Acetic Acid (2,3,6-Trichlorophenyl) Ester; (2,3,6-Trichlorophenyl) Ethanoate; 2,3,6-Trichlorophenol Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl3O2 |
| Molecular Weight | 239.49 |
| CAS Registry Number | 61925-87-9 |
| SMILES | C1=CC(=C(C(=C1Cl)Cl)OC(=O)C)Cl |
| InChI | 1S/C8H5Cl3O2/c1-4(12)13-8-6(10)3-2-5(9)7(8)11/h2-3H,1H3 |
| InChIKey | NIXCFOKFBOFURO-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.157°C at 760 mmHg (Cal.) |
| Flash point | 131.848°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Trichlorophenol Acetate |