Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (609) 434-0144 | |||
|
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 3-Maleimidobenzoic Acid Chloride |
|---|---|
| Synonyms | 3-(2,5-Dioxo-1-Pyrrolyl)Benzoyl Chloride; 3-Maleimidobenzoyl Chloride; 3-(2,5-Dihydro-2,5-Dioxo-1H-Pyrrol-1-Yl)Benzoyl Chloride |
| Molecular Structure |  |
| Molecular Formula | C11H6ClNO3 |
| Molecular Weight | 235.63 |
| CAS Registry Number | 61960-57-4 |
| EINECS | 263-354-7 |
| SMILES | C1=CC(=CC(=C1)C(=O)Cl)N2C(=O)C=CC2=O |
| InChI | 1S/C11H6ClNO3/c12-11(16)7-2-1-3-8(6-7)13-9(14)4-5-10(13)15/h1-6H |
| InChIKey | CIHNCGJBKQNXOG-UHFFFAOYSA-N |
| Density | 1.504g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.35°C at 760 mmHg (Cal.) |
| Flash point | 193.506°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Maleimidobenzoic Acid Chloride |