Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | alpha-Methyl-DL-m-Tyrosine |
|---|---|
| Synonyms | 2-Amino-3-(3-Hydroxyphenyl)-2-Methyl-Propanoic Acid; 2-Amino-3-(3-Hydroxyphenyl)-2-Methyl-Propionic Acid; (.+-.)-.Alpha.-Methyl-M-Tyrosine |
| Molecular Structure |  |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 |
| CAS Registry Number | 62-25-9 |
| SMILES | C1=C(CC(C(O)=O)(C)N)C=CC=C1O |
| InChI | 1S/C10H13NO3/c1-10(11,9(13)14)6-7-3-2-4-8(12)5-7/h2-5,12H,6,11H2,1H3,(H,13,14) |
| InChIKey | CAHPJJJZLQXPKS-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.6±32.0°C at 760 mmHg (Cal.) |
| Flash point | 187.0±25.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-DL-m-Tyrosine |