|
CAS#: 620-55-3 Product: 1-Nitro-3-Phenoxybenzene No suppilers available for the product. |
| Name | 1-Nitro-3-Phenoxybenzene |
|---|---|
| Synonyms | 1-Nitro-3-Phenoxybenzene; Ai3-02921 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 |
| CAS Registry Number | 620-55-3 |
| EINECS | 210-642-5 |
| SMILES | C1=C([N+]([O-])=O)C=CC=C1OC2=CC=CC=C2 |
| InChI | 1S/C12H9NO3/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9H |
| InChIKey | MEYCCIQOLYYNLD-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.839°C at 760 mmHg (Cal.) |
| Flash point | 142.763°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-3-Phenoxybenzene |