|
CAS#: 62061-49-8 Product: Discadenine No suppilers available for the product. |
| Name | Discadenine |
|---|---|
| Synonyms | 2-Amino-4-[6-(3-Methylbut-2-Enylamino)-3-Purinyl]Butanoic Acid; 2-Amino-4-[6-(3-Methylbut-2-Enylamino)Purin-3-Yl]Butyric Acid; Nsc289077 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 |
| CAS Registry Number | 62061-49-8 |
| SMILES | C([N]2C1=NC=NC1=C(N=C2)NCC=C(C)C)CC(C(=O)O)N |
| InChI | 1S/C14H20N6O2/c1-9(2)3-5-16-12-11-13(18-7-17-11)20(8-19-12)6-4-10(15)14(21)22/h3,7-8,10,16H,4-6,15H2,1-2H3,(H,21,22) |
| InChIKey | KGVAAXZLUAKZEO-UHFFFAOYSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.452°C at 760 mmHg (Cal.) |
| Flash point | 254.65°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Discadenine |