Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl 4-[(cyclobutylcarbonyl)amino]benzoate |
|---|---|
| Synonyms | ethyl 4-(cyclobutanecarboxamido)benzoate; ZINC05636874 |
| Molecular Structure | ![CAS#: 620103-23-3, Ethyl 4-[(cyclobutylcarbonyl)amino]benzoate](/moreStructures/620103-23-3.gif) |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 |
| CAS Registry Number | 620103-23-3 |
| SMILES | O=C(Nc1ccc(C(=O)OCC)cc1)C2CCC2 |
| InChI | 1S/C14H17NO3/c1-2-18-14(17)11-6-8-12(9-7-11)15-13(16)10-4-3-5-10/h6-10H,2-5H2,1H3,(H,15,16) |
| InChIKey | LAXRALWESSIAFM-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.439°C at 760 mmHg (Cal.) |
| Flash point | 220.775°C (Cal.) |
| Refractive index | 1.588 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-[(cyclobutylcarbonyl)amino]benzoate |