|
CAS#: 62030-88-0 Product: Duoperone No suppilers available for the product. |
| Name | Duoperone |
|---|---|
| Synonyms | (4-Fluorophenyl)-[1-[3-[2-(Trifluoromethyl)Phenothiazin-10-Yl]Propyl]-4-Piperidyl]Methanone; (4-Fluorophenyl)-[1-[3-[2-(Trifluoromethyl)-10-Phenothiazinyl]Propyl]-4-Piperidinyl]Methanone; Duoperone |
| Molecular Structure | ![]() |
| Molecular Formula | C28H26F4N2OS |
| Molecular Weight | 514.58 |
| CAS Registry Number | 62030-88-0 |
| SMILES | C1=C(C(F)(F)F)C=CC3=C1N(C2=C(C=CC=C2)S3)CCCN5CCC(C(C4=CC=C(F)C=C4)=O)CC5 |
| InChI | 1S/C28H26F4N2OS/c29-22-9-6-19(7-10-22)27(35)20-12-16-33(17-13-20)14-3-15-34-23-4-1-2-5-25(23)36-26-11-8-21(18-24(26)34)28(30,31)32/h1-2,4-11,18,20H,3,12-17H2 |
| InChIKey | XMUZRUCADGTCPX-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.512°C at 760 mmHg (Cal.) |
| Flash point | 324.841°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Duoperone |