|
CAS#: 62036-60-6 Product: 6-Tert-Butyl-4-Methyl-3-(Methylthio)-1,2,4-Triazin-5(4H)-One No suppilers available for the product. |
| Name | 6-Tert-Butyl-4-Methyl-3-(Methylthio)-1,2,4-Triazin-5(4H)-One |
|---|---|
| Synonyms | 6-Tert-Butyl-4-Methyl-3-(Methylthio)-1,2,4-Triazin-5-One; 6-Tert-Butyl-4-Methyl-3-(Methylthio)-1,2,4-Triazin-5(4H)-One |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.30 |
| CAS Registry Number | 62036-60-6 |
| EINECS | 263-380-9 |
| SMILES | CN1C(C(=NN=C1SC)C(C)(C)C)=O |
| InChI | 1S/C9H15N3OS/c1-9(2,3)6-7(13)12(4)8(14-5)11-10-6/h1-5H3 |
| InChIKey | VBTUAVIKAKCNHZ-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.451°C at 760 mmHg (Cal.) |
| Flash point | 123.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Tert-Butyl-4-Methyl-3-(Methylthio)-1,2,4-Triazin-5(4H)-One |