|
CAS#: 62049-65-4 Product: 1-(1-Chloroethyl)-4-Isobutylbenzene No suppilers available for the product. |
| Name | 1-(1-Chloroethyl)-4-Isobutylbenzene |
|---|---|
| Synonyms | 1-(1-Chloroethyl)-4-Isobutyl-Benzene; 1-(1-Chloroethyl)-4-Isobutylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17Cl |
| Molecular Weight | 196.72 |
| CAS Registry Number | 62049-65-4 |
| EINECS | 263-391-9 |
| SMILES | C1=CC(=CC=C1C(Cl)C)CC(C)C |
| InChI | 1S/C12H17Cl/c1-9(2)8-11-4-6-12(7-5-11)10(3)13/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | SPBVCQUMYJRBMD-UHFFFAOYSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.085°C at 760 mmHg (Cal.) |
| Flash point | 103.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Chloroethyl)-4-Isobutylbenzene |