Online Database of Chemicals from Around the World
|
CAS#: 62075-20-1 Product: 1-[[(2S)-1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-2H-2alpha,4aalpha-Methanonaphthalen]-8-Yl]Ethanone No suppilers available for the product. |
| Name | 1-[[(2S)-1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-2H-2alpha,4aalpha-Methanonaphthalen]-8-Yl]Ethanone |
|---|---|
| Molecular Structure | ![CAS#: 62075-20-1, 1-[[(2S)-1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-2H-2alpha,4aalpha-Methanonaphthalen]-8-Yl]Ethanone](/moreStructures/62075-20-1.gif) |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 |
| CAS Registry Number | 62075-20-1 |
| SMILES | [C@]123C(=C(CCC1(C)C)C(=O)C)C([C@H](C2)CC3)(C)C |
| InChI | 1S/C17H26O/c1-11(18)13-7-8-15(2,3)17-9-6-12(10-17)16(4,5)14(13)17/h12H,6-10H2,1-5H3/t12-,17-/m0/s1 |
| InChIKey | QXNVTDHRJFBHMW-SJCJKPOMSA-N |
| Density | 1.009g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.619°C at 760 mmHg (Cal.) |
| Flash point | 142.292°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[[(2S)-1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-2H-2alpha,4aalpha-Methanonaphthalen]-8-Yl]Ethanone |