|
CAS#: 62105-96-8 Product: 6-Fluoroserotonin No suppilers available for the product. |
| Name | 6-Fluoroserotonin |
|---|---|
| Synonyms | 6-Fluoroserotonin; Indole, 3-Ethanamine-6-Fluoro-5-Hydroxy-; 1H-Indol-5-Ol, 3-(2-Aminoethyl)-6-Fluoro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 |
| CAS Registry Number | 62105-96-8 |
| SMILES | C1=C(C2=C([NH]1)C=C(C(=C2)O)F)CCN |
| InChI | 1S/C10H11FN2O/c11-8-4-9-7(3-10(8)14)6(1-2-12)5-13-9/h3-5,13-14H,1-2,12H2 |
| InChIKey | IRQXJTNGYYCJOH-UHFFFAOYSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.603°C at 760 mmHg (Cal.) |
| Flash point | 195.473°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Fluoroserotonin |