|
CAS#: 62232-91-1 Product: 3-Methyl-1-Phenylpent-1-En-3-Ol No suppilers available for the product. |
| Name | 3-Methyl-1-Phenylpent-1-En-3-Ol |
|---|---|
| Synonyms | (E)-3-Methyl-1-Phenylpent-1-En-3-Ol; 3-Methyl-1-Phenyl-Pent-1-En-3-Ol; (E)-3-Methyl-1-Phenyl-Pent-1-En-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 62232-91-1 |
| EINECS | 263-469-2 |
| SMILES | C1=C(/C=C/C(O)(CC)C)C=CC=C1 |
| InChI | 1S/C12H16O/c1-3-12(2,13)10-9-11-7-5-4-6-8-11/h4-10,13H,3H2,1-2H3/b10-9+ |
| InChIKey | BMZIBDNSLIDIFP-MDZDMXLPSA-N |
| Density | 0.993g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.654°C at 760 mmHg (Cal.) |
| Flash point | 124.695°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-1-Phenylpent-1-En-3-Ol |