|
CAS#: 62265-33-2 Product: (S)-Methyl(alpha-Methylphenethyl)Ammonium [R-(R*,R*)]-Hydrogen Tartrate No suppilers available for the product. |
| Name | (S)-Methyl(alpha-Methylphenethyl)Ammonium [R-(R*,R*)]-Hydrogen Tartrate |
|---|---|
| Synonyms | (2S,3S)-2,3-Dihydroxybutanedioic Acid; (2R)-N-Methyl-1-Phenyl-Propan-2-Amine; Methyl-[(1R)-1-Methyl-2-Phenyl-Ethyl]Amine; Tartaric Acid; (S)-Methyl(Alpha-Methylphenethyl)Ammonium (R-(R*,R*))-Hydrogen Tartrate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 |
| CAS Registry Number | 62265-33-2 |
| EINECS | 263-475-5 |
| SMILES | [C@H](O)([C@H](O)C(=O)O)C(=O)O.[C@H](NC)(CC1=CC=CC=C1)C |
| InChI | 1S/C10H15N.C4H6O6/c1-9(11-2)8-10-6-4-3-5-7-10;5-1(3(7)8)2(6)4(9)10/h3-7,9,11H,8H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t9-;1-,2-/m10/s1 |
| InChIKey | SOSGXQJCXKXQCB-VXLLBCKSSA-N |
| Boiling point | 215.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 86.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (S)-Methyl(alpha-Methylphenethyl)Ammonium [R-(R*,R*)]-Hydrogen Tartrate |