|
CAS#: 62411-08-9 Product: (5Z,13E,15S)-15-Methyl-9alpha,11alpha,15-Trihydroxyprosta-5,13-Dien-1-Oic Acid 1,9-Lactone No suppilers available for the product. |
| Name | (5Z,13E,15S)-15-Methyl-9alpha,11alpha,15-Trihydroxyprosta-5,13-Dien-1-Oic Acid 1,9-Lactone |
|---|---|
| Synonyms | (Z)-7-[(1R,2R,5R)-3,5-Dihydroxy-2-[(E,3S)-3-Hydroxy-3-Methyl-Oct-1-Enyl]-1-Cyclopent-3-Enyl]Hept-5-Enal; (15S)-15-Methyl-Pgf2-Alpha 1,9-Lactone; (15S)-15-Methyl-Prostaglandin F2-Alpha 1,9-Lactone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 |
| CAS Registry Number | 62411-08-9 (62411-21-6) |
| SMILES | [C@H]1([C@H]([C@@H](O)C=C1O)C\C=C/CCCC=O)\C=C\[C@@](O)(CCCCC)C |
| InChI | 1S/C21H34O4/c1-3-4-9-13-21(2,25)14-12-18-17(19(23)16-20(18)24)11-8-6-5-7-10-15-22/h6,8,12,14-19,23-25H,3-5,7,9-11,13H2,1-2H3/b8-6-,14-12+/t17-,18-,19+,21+/m1/s1 |
| InChIKey | MSFNHUJDWUSYTE-GDTBAKMVSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.679°C at 760 mmHg (Cal.) |
| Flash point | 287.611°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5Z,13E,15S)-15-Methyl-9alpha,11alpha,15-Trihydroxyprosta-5,13-Dien-1-Oic Acid 1,9-Lactone |