|
CAS#: 62450-06-0 Product: 1,4-Dimethyl-9H-pyrido[4,3-b]indol-3-amine No suppilers available for the product. |
| Name | 1,4-Dimethyl-9H-pyrido[4,3-b]indol-3-amine |
|---|---|
| Synonyms | (1,4-Dimethyl-5H-Pyrido[4,5-B]Indol-3-Yl)Amine; Trp-P-1; Tryptophan P1 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 |
| CAS Registry Number | 62450-06-0 |
| SMILES | C1=CC=CC2=C1C3=C([NH]2)C(=C(N)N=C3C)C |
| InChI | 1S/C13H13N3/c1-7-12-11(8(2)15-13(7)14)9-5-3-4-6-10(9)16-12/h3-6,16H,1-2H3,(H2,14,15) |
| InChIKey | LVTKHGUGBGNBPL-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.174°C at 760 mmHg (Cal.) |
| Flash point | 262.995°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dimethyl-9H-pyrido[4,3-b]indol-3-amine |