|
CAS#: 6247-39-8 Product: Anthra[2,1,9-mna]Benz[6,7]Indazolo[2,3,4-fgh]Acridine-5,10-Dione No suppilers available for the product. |
| Name | Anthra[2,1,9-mna]Benz[6,7]Indazolo[2,3,4-fgh]Acridine-5,10-Dione |
|---|---|
| Synonyms | 4-24-00-01860 (Beilstein Handbook Reference); Ostanthren Navy Blue R; Paradone Navy Blue R |
| Molecular Structure | ![]() |
| Molecular Formula | C31H14N2O2 |
| Molecular Weight | 446.46 |
| CAS Registry Number | 6247-39-8 |
| EINECS | 228-366-9 |
| SMILES | C7=C5[N]1N=C3C2=C1C(=CC=C2C(C4=CC=CC=C34)=O)C6=CC=C8C(=C56)C(=C7)C9=C(C8=O)C=CC=C9 |
| InChI | 1S/C31H14N2O2/c34-30-20-7-3-1-5-15(20)16-13-14-24-26-17(9-11-22(30)25(16)26)19-10-12-23-27-28(32-33(24)29(19)27)18-6-2-4-8-21(18)31(23)35/h1-14H |
| InChIKey | KQXAEVNNCQHYTP-UHFFFAOYSA-N |
| Density | 1.569g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Anthra[2,1,9-mna]Benz[6,7]Indazolo[2,3,4-fgh]Acridine-5,10-Dione |