|
CAS#: 6248-04-0 Product: 2,5-Dimethyl-5-Phenyl-1,3-Dioxane No suppilers available for the product. |
| Name | 2,5-Dimethyl-5-Phenyl-1,3-Dioxane |
|---|---|
| Synonyms | 1,3-Dioxane, 2,5-Dimethyl-5-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 |
| CAS Registry Number | 6248-04-0 |
| SMILES | C1=CC=C(C=C1)C2(COC(C)OC2)C |
| InChI | 1S/C12H16O2/c1-10-13-8-12(2,9-14-10)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | YMHKDLQYBBBVSW-UHFFFAOYSA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.663°C at 760 mmHg (Cal.) |
| Flash point | 121.66°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-5-Phenyl-1,3-Dioxane |