|
CAS#: 6252-00-2 Product: Phenyl-(2-Phenyl-1,3-Dioxolan-2-Yl)Methanone No suppilers available for the product. |
| Name | Phenyl-(2-Phenyl-1,3-Dioxolan-2-Yl)Methanone |
|---|---|
| Synonyms | Nsc53723; Ghl.Pd_Mitscher_Leg0.134 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 6252-00-2 |
| SMILES | C3=CC=C(C(=O)C1(OCCO1)C2=CC=CC=C2)C=C3 |
| InChI | 1S/C16H14O3/c17-15(13-7-3-1-4-8-13)16(18-11-12-19-16)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | WVXKCTOOZUQPOK-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.046°C at 760 mmHg (Cal.) |
| Flash point | 185.506°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl-(2-Phenyl-1,3-Dioxolan-2-Yl)Methanone |