|
CAS#: 6265-94-7 Product: 2-(Phenylmethyl)-Benzothiazole No suppilers available for the product. |
| Name | 2-(Phenylmethyl)-Benzothiazole |
|---|---|
| Synonyms | 2-(Benzyl)-1,3-Benzothiazole; 2-Benzyl-1,3-Benzothiazole; Nsc33163 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NS |
| Molecular Weight | 225.31 |
| CAS Registry Number | 6265-94-7 |
| SMILES | C1=CC=CC2=C1SC(=N2)CC3=CC=CC=C3 |
| InChI | 1S/C14H11NS/c1-2-6-11(7-3-1)10-14-15-12-8-4-5-9-13(12)16-14/h1-9H,10H2 |
| InChIKey | MBWYZECWEVLZGI-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.6°C at 760 mmHg (Cal.) |
| Flash point | 183.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Phenylmethyl)-Benzothiazole |