|
CAS#: 62676-76-0 Product: 2,3-Dimethyl-1H-Indole-4,7-Dione No suppilers available for the product. |
| Name | 2,3-Dimethyl-1H-Indole-4,7-Dione |
|---|---|
| Synonyms | 2,3-Dimethyl-1H-Indole-4,7-Quinone; Aids-000188; Nsc105306 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 |
| CAS Registry Number | 62676-76-0 |
| SMILES | CC1=C([NH]C2=C1C(=O)C=CC2=O)C |
| InChI | 1S/C10H9NO2/c1-5-6(2)11-10-8(13)4-3-7(12)9(5)10/h3-4,11H,1-2H3 |
| InChIKey | RUUQDFBLUDDOPY-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.948°C at 760 mmHg (Cal.) |
| Flash point | 215.911°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyl-1H-Indole-4,7-Dione |