| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | gamma-Oxo-alpha-Phenylbenzenebutyronitrile |
|---|---|
| Synonyms | 4-Keto-2,4-Di(Phenyl)Butyronitrile; Nsc4503; 4-Oxo-2,4-Diphenyl-Butyronitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.28 |
| CAS Registry Number | 6268-00-4 |
| EINECS | 228-440-0 |
| SMILES | C2=C(C(CC(C1=CC=CC=C1)=O)C#N)C=CC=C2 |
| InChI | 1S/C16H13NO/c17-12-15(13-7-3-1-4-8-13)11-16(18)14-9-5-2-6-10-14/h1-10,15H,11H2 |
| InChIKey | JRWUFQJVJGKCCT-UHFFFAOYSA-N |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for gamma-Oxo-alpha-Phenylbenzenebutyronitrile |