|
CAS#: 62983-43-1 Product: 6-Chloro-6-Deoxyascorbic Acid No suppilers available for the product. |
| Name | 6-Chloro-6-Deoxyascorbic Acid |
|---|---|
| Synonyms | (2R)-2-[(1R)-2-Chloro-1-Hydroxy-Ethyl]-4,5-Dihydroxy-Furan-3-One; (2R)-2-[(1R)-2-Chloro-1-Hydroxyethyl]-4,5-Dihydroxy-3-Furanone; 6-Chloroascorbate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7ClO5 |
| Molecular Weight | 194.57 |
| CAS Registry Number | 62983-43-1 |
| SMILES | [C@@H]1(OC(=C(O)C1=O)O)[C@@H](O)CCl |
| InChI | 1S/C6H7ClO5/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,8,10-11H,1H2/t2-,5+/m0/s1 |
| InChIKey | MKYUKWLWCKIEDD-JLAZNSOCSA-N |
| Density | 1.871g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.578°C at 760 mmHg (Cal.) |
| Flash point | 171.872°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-6-Deoxyascorbic Acid |