Online Database of Chemicals from Around the World
|
CAS#: 6299-37-2 Product: 1,3,5-Tris(2-Chloroethyl)-1,3,5-Triazine-2,4,6(1H,3H,5H)-Trione No suppilers available for the product. |
| Name | 1,3,5-Tris(2-Chloroethyl)-1,3,5-Triazine-2,4,6(1H,3H,5H)-Trione |
|---|---|
| Synonyms | 1,3,5-Tris(2-Chloroethyl)-1,3,5-Triazine-2,4,6(1H,3H,5H)-Trione; Nsc 44649 |
| Molecular Structure |  |
| Molecular Formula | C9H12Cl3N3O3 |
| Molecular Weight | 316.57 |
| CAS Registry Number | 6299-37-2 |
| EINECS | 228-578-1 |
| SMILES | C(Cl)CN1C(=O)N(C(=O)N(C1=O)CCCl)CCCl |
| InChI | 1S/C9H12Cl3N3O3/c10-1-4-13-7(16)14(5-2-11)9(18)15(6-3-12)8(13)17/h1-6H2 |
| InChIKey | XVNBMCIQCILWHP-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.076°C at 760 mmHg (Cal.) |
| Flash point | 221.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tris(2-Chloroethyl)-1,3,5-Triazine-2,4,6(1H,3H,5H)-Trione |