Online Database of Chemicals from Around the World
| Name | 1,1-Bis(4-Chlorophenyl)-2,2,2-Trifluoroethanol |
|---|---|
| Synonyms | 1,1-Bis(4-Chlorophenyl)-2,2,2-Trifluoro-Ethanol; Brn 3361486; Benzenemethanol, 4-Chloro-Alpha-(4-Chlorophenyl)-Alpha-(Trifluoromethyl)- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C14H9Cl2F3O |
| Molecular Weight | 321.13 |
| CAS Registry Number | 630-71-7 |
| SMILES | C2=C(C(O)(C(F)(F)F)C1=CC=C(Cl)C=C1)C=CC(=C2)Cl |
| InChI | 1S/C14H9Cl2F3O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H |
| InChIKey | LARLSBWABHVOTC-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.683°C at 760 mmHg (Cal.) |
| Flash point | 187.055°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Bis(4-Chlorophenyl)-2,2,2-Trifluoroethanol |
