Online Database of Chemicals from Around the World
|
CAS#: 6301-61-7 Product: Bis[4-[(4-Nitrophenyl)Methoxy]Phenyl]Methanone No suppilers available for the product. |
| Name | Bis[4-[(4-Nitrophenyl)Methoxy]Phenyl]Methanone |
|---|---|
| Synonyms | Bis[4-(4-Nitrobenzyl)Oxyphenyl]Methanone; Nsc42484 |
| Molecular Structure | ![CAS#: 6301-61-7, Bis[4-[(4-Nitrophenyl)Methoxy]Phenyl]Methanone](/moreStructures/6301-61-7.gif) |
| Molecular Formula | C27H20N2O7 |
| Molecular Weight | 484.46 |
| CAS Registry Number | 6301-61-7 |
| SMILES | C3=C(C(=O)C2=CC=C(OCC1=CC=C([N+]([O-])=O)C=C1)C=C2)C=CC(=C3)OCC4=CC=C([N+]([O-])=O)C=C4 |
| InChI | 1S/C27H20N2O7/c30-27(21-5-13-25(14-6-21)35-17-19-1-9-23(10-2-19)28(31)32)22-7-15-26(16-8-22)36-18-20-3-11-24(12-4-20)29(33)34/h1-16H,17-18H2 |
| InChIKey | YTWCLDQYEXDPMB-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 696.593°C at 760 mmHg (Cal.) |
| Flash point | 270.899°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[4-[(4-Nitrophenyl)Methoxy]Phenyl]Methanone |