|
CAS#: 63018-59-7 Product: Benz[a]Anthracene-7-Methanethiol No suppilers available for the product. |
| Name | Benz[a]Anthracene-7-Methanethiol |
|---|---|
| Synonyms | 7-Benzo[B]Phenanthrenylmethanethiol; Benz(A)Anthracene-7-Methanethiol; Brn 3318105 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H14S |
| Molecular Weight | 274.38 |
| CAS Registry Number | 63018-59-7 |
| SMILES | C1=C3C(=C(C2=C1C=CC=C2)CS)C=CC4=C3C=CC=C4 |
| InChI | 1S/C19H14S/c20-12-19-16-8-4-2-6-14(16)11-18-15-7-3-1-5-13(15)9-10-17(18)19/h1-11,20H,12H2 |
| InChIKey | RTKQFAVQPMAHIH-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.633°C at 760 mmHg (Cal.) |
| Flash point | 211.744°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benz[a]Anthracene-7-Methanethiol |