|
CAS#: 63018-98-4 Product: 5-Acetylbenzo[c]Phenanthrene No suppilers available for the product. |
| Name | 5-Acetylbenzo[c]Phenanthrene |
|---|---|
| Synonyms | 1-(8-Benzo[C]Phenanthrenyl)Ethanone; 2-Acetyl-3:4-Benzphenanthrene; Benzo(C)Phenanthrene, 5-Acetyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14O |
| Molecular Weight | 270.33 |
| CAS Registry Number | 63018-98-4 |
| SMILES | C4=C2C=CC1=CC=CC=C1C2=C3C=CC=CC3=C4C(C)=O |
| InChI | 1S/C20H14O/c1-13(21)19-12-15-11-10-14-6-2-3-7-16(14)20(15)18-9-5-4-8-17(18)19/h2-12H,1H3 |
| InChIKey | MFBUUODCOHVEFW-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.489°C at 760 mmHg (Cal.) |
| Flash point | 222.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Acetylbenzo[c]Phenanthrene |