|
CAS#: 63020-48-4 Product: 6-Isopropyl-1,2-Benzanthracene No suppilers available for the product. |
| Name | 6-Isopropyl-1,2-Benzanthracene |
|---|---|
| Synonyms | 9-Isopropylbenzo[B]Phenanthrene; Brn 2525192; 6-Isopropyl-1:2-Benzanthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 63020-48-4 |
| SMILES | C4=CC3=CC1=C(C=CC2=CC=CC=C12)C=C3C=C4C(C)C |
| InChI | 1S/C21H18/c1-14(2)16-8-9-17-13-21-18(12-19(17)11-16)10-7-15-5-3-4-6-20(15)21/h3-14H,1-2H3 |
| InChIKey | PPSSWZLVDPGSQP-UHFFFAOYSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.389°C at 760 mmHg (Cal.) |
| Flash point | 223.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Isopropyl-1,2-Benzanthracene |