|
CAS#: 63040-45-9 Product: 2,3-Dihydro-3,6-Dimethyl-1H-Cyclopent[a]Anthracene No suppilers available for the product. |
| Name | 2,3-Dihydro-3,6-Dimethyl-1H-Cyclopent[a]Anthracene |
|---|---|
| Synonyms | 2,3-Dihydro-3,6-Dimethyl-1H-Cyclopenta(A)Anthracene; 4-05-00-02442 (Beilstein Handbook Reference); Brn 2561798 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 |
| CAS Registry Number | 63040-45-9 |
| SMILES | C1=C4C(=C3C(=C1)C(=C2C=CC=CC2=C3)C)CCC4C |
| InChI | 1S/C19H18/c1-12-7-8-18-15(12)9-10-17-13(2)16-6-4-3-5-14(16)11-19(17)18/h3-6,9-12H,7-8H2,1-2H3 |
| InChIKey | FQLXHPIAVANCEN-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.664°C at 760 mmHg (Cal.) |
| Flash point | 201.937°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-3,6-Dimethyl-1H-Cyclopent[a]Anthracene |