|
CAS#: 63041-88-3 Product: 6-Methyl-11H-Benz[bc]Aceanthrylene No suppilers available for the product. |
| Name | 6-Methyl-11H-Benz[bc]Aceanthrylene |
|---|---|
| Synonyms | 11H-Benz(Bc)Aceanthrylene, 6-Methyl-; Brn 3134754 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 |
| CAS Registry Number | 63041-88-3 |
| SMILES | C1=CC=C2C(=C1)C5=C3C(=C2C)C=CC4=C3C(=CC=C4)C5 |
| InChI | 1S/C20H14/c1-12-15-7-2-3-8-17(15)18-11-14-6-4-5-13-9-10-16(12)20(18)19(13)14/h2-10H,11H2,1H3 |
| InChIKey | IJAOHUABITVDOH-UHFFFAOYSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.259°C at 760 mmHg (Cal.) |
| Flash point | 237.106°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-11H-Benz[bc]Aceanthrylene |