|
CAS#: 6305-64-2 Product: N-(4-Butylsulfonylphenyl)Acetamide No suppilers available for the product. |
| Name | N-(4-Butylsulfonylphenyl)Acetamide |
|---|---|
| Synonyms | N-(4-Butylsulfonylphenyl)Ethanamide; Nsc41170 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.33 |
| CAS Registry Number | 6305-64-2 |
| SMILES | C1=CC(=CC=C1[S](=O)(CCCC)=O)NC(C)=O |
| InChI | 1S/C12H17NO3S/c1-3-4-9-17(15,16)12-7-5-11(6-8-12)13-10(2)14/h5-8H,3-4,9H2,1-2H3,(H,13,14) |
| InChIKey | LFDZPQHFCXSHJV-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.226°C at 760 mmHg (Cal.) |
| Flash point | 249.071°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Butylsulfonylphenyl)Acetamide |