|
CAS#: 6308-31-2 Product: 4-Methyl-6-[(4-Nitrophenyl)Methylsulfanyl]Pyrimidin-2-Amine No suppilers available for the product. |
| Name | 4-Methyl-6-[(4-Nitrophenyl)Methylsulfanyl]Pyrimidin-2-Amine |
|---|---|
| Synonyms | 4-Methyl-6-[(4-Nitrophenyl)Methylthio]-2-Pyrimidinamine; [4-Methyl-6-[(4-Nitrobenzyl)Thio]Pyrimidin-2-Yl]Amine; Nsc42019 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.31 |
| CAS Registry Number | 6308-31-2 |
| SMILES | C1=CC(=CC=C1CSC2=CC(=NC(=N2)N)C)[N+]([O-])=O |
| InChI | 1S/C12H12N4O2S/c1-8-6-11(15-12(13)14-8)19-7-9-2-4-10(5-3-9)16(17)18/h2-6H,7H2,1H3,(H2,13,14,15) |
| InChIKey | UUJNHOPDGGNCPM-UHFFFAOYSA-N |
| Density | 1.399g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.695°C at 760 mmHg (Cal.) |
| Flash point | 278.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-6-[(4-Nitrophenyl)Methylsulfanyl]Pyrimidin-2-Amine |