|
CAS#: 6310-14-1 Product: (Z)-1-(4-Methoxyphenyl)Ethylidenehydrazine No suppilers available for the product. |
| Name | (Z)-1-(4-Methoxyphenyl)Ethylidenehydrazine |
|---|---|
| Synonyms | 1-(4-Methoxyphenyl)Ethanone Hydrazone; Aids-124644; Aids124644 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 |
| CAS Registry Number | 6310-14-1 |
| SMILES | C1=C(C(=N/N)\C)C=CC(=C1)OC |
| InChI | 1S/C9H12N2O/c1-7(11-10)8-3-5-9(12-2)6-4-8/h3-6H,10H2,1-2H3/b11-7- |
| InChIKey | ADNJIMDVLSCPOA-XFFZJAGNSA-N |
| Density | 1.059g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.207°C at 760 mmHg (Cal.) |
| Flash point | 126.894°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-1-(4-Methoxyphenyl)Ethylidenehydrazine |