|
CAS#: 6312-01-2 Product: 4,4-Dimethyl-1-Pyridin-4-Yl-Pentane-1,3-Dione No suppilers available for the product. |
| Name | 4,4-Dimethyl-1-Pyridin-4-Yl-Pentane-1,3-Dione |
|---|---|
| Synonyms | 4,4-Dimethyl-1-(4-Pyridyl)Pentane-1,3-Dione; 4,4-Dimethyl-1-Pyridin-4-Yl-Pentane-1,3-Dione; Nsc42658 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 |
| CAS Registry Number | 6312-01-2 |
| SMILES | C1=CC(=CC=N1)C(=O)CC(=O)C(C)(C)C |
| InChI | 1S/C12H15NO2/c1-12(2,3)11(15)8-10(14)9-4-6-13-7-5-9/h4-7H,8H2,1-3H3 |
| InChIKey | UDVGQWHYFLERJZ-UHFFFAOYSA-N |
| Density | 1.059g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.264°C at 760 mmHg (Cal.) |
| Flash point | 151.92°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-1-Pyridin-4-Yl-Pentane-1,3-Dione |