|
CAS#: 6312-31-8 Product: 2-Phenyl-4-Pyridin-2-Yl-Butanoic Acid No suppilers available for the product. |
| Name | 2-Phenyl-4-Pyridin-2-Yl-Butanoic Acid |
|---|---|
| Synonyms | 2-Phenyl-4-(2-Pyridyl)Butanoic Acid; 2-Phenyl-4-(2-Pyridyl)Butyric Acid; 2-Phenyl-4-Pyridin-2-Yl-Butanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 6312-31-8 |
| SMILES | C2=C(CCC(C(O)=O)C1=CC=CC=C1)N=CC=C2 |
| InChI | 1S/C15H15NO2/c17-15(18)14(12-6-2-1-3-7-12)10-9-13-8-4-5-11-16-13/h1-8,11,14H,9-10H2,(H,17,18) |
| InChIKey | SSRVHSJNWMCPCE-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.067°C at 760 mmHg (Cal.) |
| Flash point | 183.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-4-Pyridin-2-Yl-Butanoic Acid |