|
CAS#: 6318-01-0 Product: 2,4-Dichloro-N-(4-Chlorophenyl)-5,6,7,8-Tetrahydroquinazoline-6-Carboxamide No suppilers available for the product. |
| Name | 2,4-Dichloro-N-(4-Chlorophenyl)-5,6,7,8-Tetrahydroquinazoline-6-Carboxamide |
|---|---|
| Synonyms | Nsc27376 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12Cl3N3O |
| Molecular Weight | 356.64 |
| CAS Registry Number | 6318-01-0 |
| SMILES | C1=CC(=CC=C1NC(C3CCC2=C(C(=NC(=N2)Cl)Cl)C3)=O)Cl |
| InChI | 1S/C15H12Cl3N3O/c16-9-2-4-10(5-3-9)19-14(22)8-1-6-12-11(7-8)13(17)21-15(18)20-12/h2-5,8H,1,6-7H2,(H,19,22) |
| InChIKey | OBIZLUAEPTUEMS-UHFFFAOYSA-N |
| Density | 1.504g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.523°C at 760 mmHg (Cal.) |
| Flash point | 308.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-N-(4-Chlorophenyl)-5,6,7,8-Tetrahydroquinazoline-6-Carboxamide |