|
CAS#: 6328-73-0 Product: 1-Chloro-4-Methoxysulfonyl-Naphthalene No suppilers available for the product. |
| Name | 1-Chloro-4-Methoxysulfonyl-Naphthalene |
|---|---|
| Synonyms | 4-Chloro-1-Naphthalenesulfonic Acid Methyl Ester; 4-Chloronaphthalene-1-Sulfonic Acid Methyl Ester; Nsc43855 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9ClO3S |
| Molecular Weight | 256.70 |
| CAS Registry Number | 6328-73-0 |
| SMILES | C2=C([S](=O)(=O)OC)C1=C(C=CC=C1)C(=C2)Cl |
| InChI | 1S/C11H9ClO3S/c1-15-16(13,14)11-7-6-10(12)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| InChIKey | REGZMWKQNLHMQX-UHFFFAOYSA-N |
| Density | 1.398g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.94°C at 760 mmHg (Cal.) |
| Flash point | 197.492°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-Methoxysulfonyl-Naphthalene |