|
CAS#: 63297-21-2 Product: 2,4,5,6,7,8-Hexamethyl-Azulene No suppilers available for the product. |
| Name | 2,4,5,6,7,8-Hexamethyl-Azulene |
|---|---|
| Synonyms | Azulene, 2,4,5,6,7,8-Hexamethyl-; Azulene,2,4,5,6,7,8-Hexamethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.33 |
| CAS Registry Number | 63297-21-2 |
| SMILES | CC2=C1C(=CC(=C1)C)C(=C(C(=C2C)C)C)C |
| InChI | 1S/C16H20/c1-9-7-15-13(5)11(3)10(2)12(4)14(6)16(15)8-9/h7-8H,1-6H3 |
| InChIKey | FPIBSYQDWJCGDO-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.61°C at 760 mmHg (Cal.) |
| Flash point | 176.453°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5,6,7,8-Hexamethyl-Azulene |